About 2-isocyanato-4,5-dimethyl-1,3-thiazole
2-isocyanato-4,5-dimethyl-1,3-thiazole (PubChem CID 23062273) has the molecular formula C6H6N2OS
and a molecular weight of 154.19 g/mol. Its IUPAC name is 2-isocyanato-4,5-dimethyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-isocyanato-4,5-dimethyl-1,3-thiazole |
| PubChem CID | 23062273 |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 2-isocyanato-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(N=C=O)sc1C |
| InChI | InChI=1S/C6H6N2OS/c1-4-5(2)10-6(8-4)7-3-9/h1-2H3 |
| InChIKey | BDCRRSIQQVWEKI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanato-4,5-dimethyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanato-4,5-dimethyl-1,3-thiazole?
The IUPAC name of 2-isocyanato-4,5-dimethyl-1,3-thiazole (CID 23062273) is 2-isocyanato-4,5-dimethyl-1,3-thiazole.
What is the SMILES notation for 2-isocyanato-4,5-dimethyl-1,3-thiazole?
The canonical SMILES for 2-isocyanato-4,5-dimethyl-1,3-thiazole is Cc1nc(N=C=O)sc1C.
What is the InChIKey of 2-isocyanato-4,5-dimethyl-1,3-thiazole?
The InChIKey is BDCRRSIQQVWEKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2OS/c1-4-5(2)10-6(8-4)7-3-9/h1-2H3.
What are the key properties of 2-isocyanato-4,5-dimethyl-1,3-thiazole?
2-isocyanato-4,5-dimethyl-1,3-thiazole has a molecular weight of 154.19 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanato-4,5-dimethyl-1,3-thiazole is sourced from PubChem (CID 23062273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).