About 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride
2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride (PubChem CID 23062942) has the molecular formula C11H20ClNO3
and a molecular weight of 249.74 g/mol. Its IUPAC name is 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride.
Molecular Properties
| Compound Name | 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride |
| PubChem CID | 23062942 |
| Molecular Formula | C11H20ClNO3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride |
| SMILES | C=C(C)C(=O)OCC[N+]1(C)CCOCC1.[Cl-] |
| InChI | InChI=1S/C11H20NO3.ClH/c1-10(2)11(13)15-9-6-12(3)4-7-14-8-5-12;/h1,4-9H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | ICIZZTPTEAUVSA-UHFFFAOYSA-M |
| XLogP | -2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride?
The IUPAC name of 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride (CID 23062942) is 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride.
What is the SMILES notation for 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride?
The canonical SMILES for 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride is C=C(C)C(=O)OCC[N+]1(C)CCOCC1.[Cl-].
What is the InChIKey of 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride?
The InChIKey is ICIZZTPTEAUVSA-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H20NO3.ClH/c1-10(2)11(13)15-9-6-12(3)4-7-14-8-5-12;/h1,4-9H2,2-3H3;1H/q+1;/p-1.
What are the key properties of 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride?
2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride has a molecular weight of 249.74 g/mol, XLogP of -2.41, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylmorpholin-4-ium-4-yl)ethyl 2-methylprop-2-enoate chloride is sourced from PubChem (CID 23062942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).