About 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one
3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one (PubChem CID 2306342) has the molecular formula C12H5BrN4O5
and a molecular weight of 365.10 g/mol. Its IUPAC name is 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one.
Molecular Properties
| Compound Name | 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one |
| PubChem CID | 2306342 |
| Molecular Formula | C12H5BrN4O5 |
| Molecular Weight | 365.10 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one |
| SMILES | O=c1c2cc(Br)cnc2[nH]c2c([N+](=O)[O-])cc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C12H5BrN4O5/c13-5-1-8-11(18)7-2-6(16(19)20)3-9(17(21)22)10(7)15-12(8)14-4-5/h1-4H,(H,14,15,18) |
| InChIKey | DHRHRTKSPSBZNM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.10 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one?
The IUPAC name of 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one (CID 2306342) is 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one.
What is the SMILES notation for 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one?
The canonical SMILES for 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one is O=c1c2cc(Br)cnc2[nH]c2c([N+](=O)[O-])cc([N+](=O)[O-])cc12.
What is the InChIKey of 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one?
The InChIKey is DHRHRTKSPSBZNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5BrN4O5/c13-5-1-8-11(18)7-2-6(16(19)20)3-9(17(21)22)10(7)15-12(8)14-4-5/h1-4H,(H,14,15,18).
What are the key properties of 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one?
3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one has a molecular weight of 365.10 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-7,9-dinitro-10H-benzo[b][1,8]naphthyridin-5-one is sourced from PubChem (CID 2306342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).