About 4-octylsulfonylbenzene-1,2-dicarbonitrile
4-octylsulfonylbenzene-1,2-dicarbonitrile (PubChem CID 23063614) has the molecular formula C16H20N2O2S
and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-octylsulfonylbenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-octylsulfonylbenzene-1,2-dicarbonitrile |
| PubChem CID | 23063614 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-octylsulfonylbenzene-1,2-dicarbonitrile |
| SMILES | CCCCCCCCS(=O)(=O)c1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-2-3-4-5-6-7-10-21(19,20)16-9-8-14(12-17)15(11-16)13-18/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | PGGGUGJVICEUJA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-octylsulfonylbenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-octylsulfonylbenzene-1,2-dicarbonitrile?
The IUPAC name of 4-octylsulfonylbenzene-1,2-dicarbonitrile (CID 23063614) is 4-octylsulfonylbenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-octylsulfonylbenzene-1,2-dicarbonitrile?
The canonical SMILES for 4-octylsulfonylbenzene-1,2-dicarbonitrile is CCCCCCCCS(=O)(=O)c1ccc(C#N)c(C#N)c1.
What is the InChIKey of 4-octylsulfonylbenzene-1,2-dicarbonitrile?
The InChIKey is PGGGUGJVICEUJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2S/c1-2-3-4-5-6-7-10-21(19,20)16-9-8-14(12-17)15(11-16)13-18/h8-9,11H,2-7,10H2,1H3.
What are the key properties of 4-octylsulfonylbenzene-1,2-dicarbonitrile?
4-octylsulfonylbenzene-1,2-dicarbonitrile has a molecular weight of 304.42 g/mol, XLogP of 3.56, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octylsulfonylbenzene-1,2-dicarbonitrile is sourced from PubChem (CID 23063614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).