About (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine
(1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine (PubChem CID 23063674) has the molecular formula C5H12N4
and a molecular weight of 128.18 g/mol. Its IUPAC name is (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine.
Molecular Properties
| Compound Name | (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine |
| PubChem CID | 23063674 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine |
| SMILES | CC1CN=C(NN)N1C |
| InChI | InChI=1S/C5H12N4/c1-4-3-7-5(8-6)9(4)2/h4H,3,6H2,1-2H3,(H,7,8) |
| InChIKey | MKJJRKOGUPFTBW-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine?
The IUPAC name of (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine (CID 23063674) is (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine.
What is the SMILES notation for (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine?
The canonical SMILES for (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine is CC1CN=C(NN)N1C.
What is the InChIKey of (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine?
The InChIKey is MKJJRKOGUPFTBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N4/c1-4-3-7-5(8-6)9(4)2/h4H,3,6H2,1-2H3,(H,7,8).
What are the key properties of (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine?
(1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine has a molecular weight of 128.18 g/mol, XLogP of -0.86, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,5-dimethyl-4,5-dihydroimidazol-2-yl)hydrazine is sourced from PubChem (CID 23063674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).