About [4-(aminomethyl)phenyl] propanoate
[4-(aminomethyl)phenyl] propanoate (PubChem CID 23063742) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl] propanoate.
Molecular Properties
| Compound Name | [4-(aminomethyl)phenyl] propanoate |
| PubChem CID | 23063742 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | [4-(aminomethyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(CN)cc1 |
| InChI | InChI=1S/C10H13NO2/c1-2-10(12)13-9-5-3-8(7-11)4-6-9/h3-6H,2,7,11H2,1H3 |
| InChIKey | QGLDUDQHLHOZGB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(aminomethyl)phenyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)phenyl] propanoate?
The IUPAC name of [4-(aminomethyl)phenyl] propanoate (CID 23063742) is [4-(aminomethyl)phenyl] propanoate.
What is the SMILES notation for [4-(aminomethyl)phenyl] propanoate?
The canonical SMILES for [4-(aminomethyl)phenyl] propanoate is CCC(=O)Oc1ccc(CN)cc1.
What is the InChIKey of [4-(aminomethyl)phenyl] propanoate?
The InChIKey is QGLDUDQHLHOZGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-2-10(12)13-9-5-3-8(7-11)4-6-9/h3-6H,2,7,11H2,1H3.
What are the key properties of [4-(aminomethyl)phenyl] propanoate?
[4-(aminomethyl)phenyl] propanoate has a molecular weight of 179.22 g/mol, XLogP of 1.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)phenyl] propanoate is sourced from PubChem (CID 23063742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).