About N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide
N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide (PubChem CID 23064233) has the molecular formula C13H16N2O3
and a molecular weight of 248.28 g/mol. Its IUPAC name is N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide.
Molecular Properties
| Compound Name | N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide |
| PubChem CID | 23064233 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide |
| SMILES | CCC(=O)Nc1ccc2c(c1O)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C13H16N2O3/c1-4-9(16)14-8-6-5-7-10(11(8)17)13(2,3)12(18)15-7/h5-6,17H,4H2,1-3H3,(H,14,16)(H,15,18) |
| InChIKey | WZOIPLDJPZQCGL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide?
The IUPAC name of N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide (CID 23064233) is N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide.
What is the SMILES notation for N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide?
The canonical SMILES for N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide is CCC(=O)Nc1ccc2c(c1O)C(C)(C)C(=O)N2.
What is the InChIKey of N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide?
The InChIKey is WZOIPLDJPZQCGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3/c1-4-9(16)14-8-6-5-7-10(11(8)17)13(2,3)12(18)15-7/h5-6,17H,4H2,1-3H3,(H,14,16)(H,15,18).
What are the key properties of N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide?
N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide has a molecular weight of 248.28 g/mol, XLogP of 1.97, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)propanamide is sourced from PubChem (CID 23064233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).