C14H17ClN2O3 — CID 23064238
N-(8-chloro-5-hydroxy-4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)propanamide (PubChem CID 23064238) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is N-(8-chloro-5-hydroxy-4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)propanamide.
| Compound Name | N-(8-chloro-5-hydroxy-4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)propanamide |
|---|---|
| PubChem CID | 23064238 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-(8-chloro-5-hydroxy-4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)propanamide |
| SMILES | CCC(=O)Nc1cc(Cl)c2c(c1O)C(C)(C)CC(=O)N2 |
| InChI | InChI=1S/C14H17ClN2O3/c1-4-9(18)16-8-5-7(15)12-11(13(8)20)14(2,3)6-10(19)17-12/h5,20H,4,6H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | JDJZWDSVAMHOIU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|