About methanol;1-(2-oxopropoxy)propan-2-one
methanol;1-(2-oxopropoxy)propan-2-one (PubChem CID 23064730) has the molecular formula C7H14O4
and a molecular weight of 162.19 g/mol. Its IUPAC name is methanol;1-(2-oxopropoxy)propan-2-one.
Molecular Properties
| Compound Name | methanol;1-(2-oxopropoxy)propan-2-one |
| PubChem CID | 23064730 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | methanol;1-(2-oxopropoxy)propan-2-one |
| SMILES | CC(=O)COCC(C)=O.CO |
| InChI | InChI=1S/C6H10O3.CH4O/c1-5(7)3-9-4-6(2)8;1-2/h3-4H2,1-2H3;2H,1H3 |
| InChIKey | CTUWOGGDFWJFDK-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanol;1-(2-oxopropoxy)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;1-(2-oxopropoxy)propan-2-one?
The IUPAC name of methanol;1-(2-oxopropoxy)propan-2-one (CID 23064730) is methanol;1-(2-oxopropoxy)propan-2-one.
What is the SMILES notation for methanol;1-(2-oxopropoxy)propan-2-one?
The canonical SMILES for methanol;1-(2-oxopropoxy)propan-2-one is CC(=O)COCC(C)=O.CO.
What is the InChIKey of methanol;1-(2-oxopropoxy)propan-2-one?
The InChIKey is CTUWOGGDFWJFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.CH4O/c1-5(7)3-9-4-6(2)8;1-2/h3-4H2,1-2H3;2H,1H3.
What are the key properties of methanol;1-(2-oxopropoxy)propan-2-one?
methanol;1-(2-oxopropoxy)propan-2-one has a molecular weight of 162.19 g/mol, XLogP of -0.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;1-(2-oxopropoxy)propan-2-one is sourced from PubChem (CID 23064730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).