1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid

C6H10N2O3S — CID 23064855

IUPAC1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid
SMILESNC1C=CC=CC1(N)S(=O)(=O)O
InChIInChI=1S/C6H10N2O3S/c7-5-3-1-2-4-6(5,8)12(9,10)11/h1-5H,7-8H2,(H,9,10,11)
InChIKeyDGCVEJYYCAIDGG-UHFFFAOYSA-N
MW190.22 g/mol
LogP-1.02
Rot. Bonds1

About 1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid

1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 23064855) has the molecular formula C6H10N2O3S and a molecular weight of 190.22 g/mol. Its IUPAC name is 1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid.

Molecular Properties

Compound Name1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid
PubChem CID23064855
Molecular FormulaC6H10N2O3S
Molecular Weight190.22 g/mol
Exact Mass190.04
IUPAC Name1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid
SMILESNC1C=CC=CC1(N)S(=O)(=O)O
InChIInChI=1S/C6H10N2O3S/c7-5-3-1-2-4-6(5,8)12(9,10)11/h1-5H,7-8H2,(H,9,10,11)
InChIKeyDGCVEJYYCAIDGG-UHFFFAOYSA-N
XLogP-1.02
TPSA106.41 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.22
LogP ≤ 5-1.02
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid?
The IUPAC name of 1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid (CID 23064855) is 1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid.
What is the SMILES notation for 1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid?
The canonical SMILES for 1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid is NC1C=CC=CC1(N)S(=O)(=O)O.
What is the InChIKey of 1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid?
The InChIKey is DGCVEJYYCAIDGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3S/c7-5-3-1-2-4-6(5,8)12(9,10)11/h1-5H,7-8H2,(H,9,10,11).
What are the key properties of 1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid?
1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid has a molecular weight of 190.22 g/mol, XLogP of -1.02, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid is sourced from PubChem (CID 23064855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).