About ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate
ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate (PubChem CID 23064923) has the molecular formula C12H13NO4
and a molecular weight of 235.24 g/mol. Its IUPAC name is ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate.
Molecular Properties
| Compound Name | ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate |
| PubChem CID | 23064923 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate |
| SMILES | CCOC(=O)OC1=NOC(c2ccccc2)C1 |
| InChI | InChI=1S/C12H13NO4/c1-2-15-12(14)16-11-8-10(17-13-11)9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3 |
| InChIKey | DDALLBJLCYLQQN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate?
The IUPAC name of ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate (CID 23064923) is ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate.
What is the SMILES notation for ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate?
The canonical SMILES for ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate is CCOC(=O)OC1=NOC(c2ccccc2)C1.
What is the InChIKey of ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate?
The InChIKey is DDALLBJLCYLQQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4/c1-2-15-12(14)16-11-8-10(17-13-11)9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3.
What are the key properties of ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate?
ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate has a molecular weight of 235.24 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (5-phenyl-4,5-dihydro-1,2-oxazol-3-yl) carbonate is sourced from PubChem (CID 23064923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).