About 1-butyl-3,4,5-trimethyl-2H-imidazole
1-butyl-3,4,5-trimethyl-2H-imidazole (PubChem CID 23065778) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-butyl-3,4,5-trimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 1-butyl-3,4,5-trimethyl-2H-imidazole |
| PubChem CID | 23065778 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-butyl-3,4,5-trimethyl-2H-imidazole |
| SMILES | CCCCN1CN(C)C(C)=C1C |
| InChI | InChI=1S/C10H20N2/c1-5-6-7-12-8-11(4)9(2)10(12)3/h5-8H2,1-4H3 |
| InChIKey | NUERQGVFBSQRBK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-3,4,5-trimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3,4,5-trimethyl-2H-imidazole?
The IUPAC name of 1-butyl-3,4,5-trimethyl-2H-imidazole (CID 23065778) is 1-butyl-3,4,5-trimethyl-2H-imidazole.
What is the SMILES notation for 1-butyl-3,4,5-trimethyl-2H-imidazole?
The canonical SMILES for 1-butyl-3,4,5-trimethyl-2H-imidazole is CCCCN1CN(C)C(C)=C1C.
What is the InChIKey of 1-butyl-3,4,5-trimethyl-2H-imidazole?
The InChIKey is NUERQGVFBSQRBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-5-6-7-12-8-11(4)9(2)10(12)3/h5-8H2,1-4H3.
What are the key properties of 1-butyl-3,4,5-trimethyl-2H-imidazole?
1-butyl-3,4,5-trimethyl-2H-imidazole has a molecular weight of 168.28 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3,4,5-trimethyl-2H-imidazole is sourced from PubChem (CID 23065778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).