About [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate
[2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate (PubChem CID 23066406) has the molecular formula C13H18O12
and a molecular weight of 366.28 g/mol. Its IUPAC name is [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate.
Molecular Properties
| Compound Name | [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate |
| PubChem CID | 23066406 |
| Molecular Formula | C13H18O12 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate |
| SMILES | COC(=O)OC1CC(OC(=O)OC)C(OC(=O)OC)CC1OC(=O)O |
| InChI | InChI=1S/C13H18O12/c1-19-11(16)23-7-5-9(25-13(18)21-3)8(24-12(17)20-2)4-6(7)22-10(14)15/h6-9H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | IDQMHJZCJLOWRS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate?
The IUPAC name of [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate (CID 23066406) is [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate.
What is the SMILES notation for [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate?
The canonical SMILES for [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate is COC(=O)OC1CC(OC(=O)OC)C(OC(=O)OC)CC1OC(=O)O.
What is the InChIKey of [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate?
The InChIKey is IDQMHJZCJLOWRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O12/c1-19-11(16)23-7-5-9(25-13(18)21-3)8(24-12(17)20-2)4-6(7)22-10(14)15/h6-9H,4-5H2,1-3H3,(H,14,15).
What are the key properties of [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate?
[2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate has a molecular weight of 366.28 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [2-carboxyoxy-4,5-bis(methoxycarbonyloxy)cyclohexyl] methyl carbonate is sourced from PubChem (CID 23066406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).