C23H44O5Si — CID 23067013
2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8-tetramethyl-5-oxotridec-12-enoic acid (PubChem CID 23067013) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8-tetramethyl-5-oxotridec-12-enoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8-tetramethyl-5-oxotridec-12-enoic acid |
|---|---|
| PubChem CID | 23067013 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4,6,8-tetramethyl-5-oxotridec-12-enoic acid |
| SMILES | C=CCCCC(C)C(O)C(C)C(=O)C(C)(C)CC(O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C23H44O5Si/c1-11-12-13-14-16(2)19(24)17(3)20(25)23(7,8)15-18(21(26)27)28-29(9,10)22(4,5)6/h11,16-19,24H,1,12-15H2,2-10H3,(H,26,27) |
| InChIKey | OMWXRFPVKVVPPP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|