C13H12N6OS2 — CID 23067404
2-amino-N-(4-methyl-1,3-thiazol-2-yl)-5-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide (PubChem CID 23067404) has the molecular formula C13H12N6OS2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-amino-N-(4-methyl-1,3-thiazol-2-yl)-5-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide.
| Compound Name | 2-amino-N-(4-methyl-1,3-thiazol-2-yl)-5-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 23067404 |
| Molecular Formula | C13H12N6OS2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-amino-N-(4-methyl-1,3-thiazol-2-yl)-5-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide |
| SMILES | Cc1csc(NC(=O)c2cc(Sc3ncn[nH]3)ccc2N)n1 |
| InChI | InChI=1S/C13H12N6OS2/c1-7-5-21-13(17-7)18-11(20)9-4-8(2-3-10(9)14)22-12-15-6-16-19-12/h2-6H,14H2,1H3,(H,15,16,19)(H,17,18,20) |
| InChIKey | VHPZLMWISYFRDK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|