C10H17NSi2 — CID 23067506
1,1,3,3-tetramethyl-2H-2,1,3-benzazadisilole (PubChem CID 23067506) has the molecular formula C10H17NSi2 and a molecular weight of 207.43 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2H-2,1,3-benzazadisilole.
| Compound Name | 1,1,3,3-tetramethyl-2H-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 23067506 |
| Molecular Formula | C10H17NSi2 |
| Molecular Weight | 207.43 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1,1,3,3-tetramethyl-2H-2,1,3-benzazadisilole |
| SMILES | C[Si]1(C)N[Si](C)(C)c2ccccc21 |
| InChI | InChI=1S/C10H17NSi2/c1-12(2)9-7-5-6-8-10(9)13(3,4)11-12/h5-8,11H,1-4H3 |
| InChIKey | VPLHRZBRWMWQSX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|