C18H26FN3O — CID 23067698
8-fluoro-8-methyl-1-phenyl-5-(1H-1,2,4-triazol-5-yl)nonan-3-ol (PubChem CID 23067698) has the molecular formula C18H26FN3O and a molecular weight of 319.42 g/mol. Its IUPAC name is 8-fluoro-8-methyl-1-phenyl-5-(1H-1,2,4-triazol-5-yl)nonan-3-ol.
| Compound Name | 8-fluoro-8-methyl-1-phenyl-5-(1H-1,2,4-triazol-5-yl)nonan-3-ol |
|---|---|
| PubChem CID | 23067698 |
| Molecular Formula | C18H26FN3O |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 8-fluoro-8-methyl-1-phenyl-5-(1H-1,2,4-triazol-5-yl)nonan-3-ol |
| SMILES | CC(C)(F)CCC(CC(O)CCc1ccccc1)c1ncn[nH]1 |
| InChI | InChI=1S/C18H26FN3O/c1-18(2,19)11-10-15(17-20-13-21-22-17)12-16(23)9-8-14-6-4-3-5-7-14/h3-7,13,15-16,23H,8-12H2,1-2H3,(H,20,21,22) |
| InChIKey | CPXQLWHAMKOPQT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |