About dibenzyl 3-hydroxypentanedioate
dibenzyl 3-hydroxypentanedioate (PubChem CID 23067924) has the molecular formula C19H20O5
and a molecular weight of 328.36 g/mol. Its IUPAC name is dibenzyl 3-hydroxypentanedioate.
Molecular Properties
| Compound Name | dibenzyl 3-hydroxypentanedioate |
| PubChem CID | 23067924 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | dibenzyl 3-hydroxypentanedioate |
| SMILES | O=C(CC(O)CC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C19H20O5/c20-17(11-18(21)23-13-15-7-3-1-4-8-15)12-19(22)24-14-16-9-5-2-6-10-16/h1-10,17,20H,11-14H2 |
| InChIKey | XMVUAFOCZMGQJC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dibenzyl 3-hydroxypentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl 3-hydroxypentanedioate?
The IUPAC name of dibenzyl 3-hydroxypentanedioate (CID 23067924) is dibenzyl 3-hydroxypentanedioate.
What is the SMILES notation for dibenzyl 3-hydroxypentanedioate?
The canonical SMILES for dibenzyl 3-hydroxypentanedioate is O=C(CC(O)CC(=O)OCc1ccccc1)OCc1ccccc1.
What is the InChIKey of dibenzyl 3-hydroxypentanedioate?
The InChIKey is XMVUAFOCZMGQJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O5/c20-17(11-18(21)23-13-15-7-3-1-4-8-15)12-19(22)24-14-16-9-5-2-6-10-16/h1-10,17,20H,11-14H2.
What are the key properties of dibenzyl 3-hydroxypentanedioate?
dibenzyl 3-hydroxypentanedioate has a molecular weight of 328.36 g/mol, XLogP of 2.61, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl 3-hydroxypentanedioate is sourced from PubChem (CID 23067924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).