C16H14F8N2O2 — CID 2306849
1,1,2,2,4,4,5,5-octafluoropentan-3-yl 1-ethyl-2-methylbenzimidazole-5-carboxylate (PubChem CID 2306849) has the molecular formula C16H14F8N2O2 and a molecular weight of 418.28 g/mol. Its IUPAC name is 1,1,2,2,4,4,5,5-octafluoropentan-3-yl 1-ethyl-2-methylbenzimidazole-5-carboxylate.
| Compound Name | 1,1,2,2,4,4,5,5-octafluoropentan-3-yl 1-ethyl-2-methylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 2306849 |
| Molecular Formula | C16H14F8N2O2 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 1,1,2,2,4,4,5,5-octafluoropentan-3-yl 1-ethyl-2-methylbenzimidazole-5-carboxylate |
| SMILES | CCn1c(C)nc2cc(C(=O)OC(C(F)(F)C(F)F)C(F)(F)C(F)F)ccc21 |
| InChI | InChI=1S/C16H14F8N2O2/c1-3-26-7(2)25-9-6-8(4-5-10(9)26)11(27)28-12(15(21,22)13(17)18)16(23,24)14(19)20/h4-6,12-14H,3H2,1-2H3 |
| InChIKey | NAFPTYUFWLVVOI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|