C24H27N3O — CID 2306928
(2Z)-2-[[4-[benzyl(ethyl)amino]phenyl]methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one (PubChem CID 2306928) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is (2Z)-2-[[4-[benzyl(ethyl)amino]phenyl]methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one.
| Compound Name | (2Z)-2-[[4-[benzyl(ethyl)amino]phenyl]methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one |
|---|---|
| PubChem CID | 2306928 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | (2Z)-2-[[4-[benzyl(ethyl)amino]phenyl]methylidene]-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-3-one |
| SMILES | CCN(Cc1ccccc1)c1ccc(/C=C2\N=C3CCCCCN3C2=O)cc1 |
| InChI | InChI=1S/C24H27N3O/c1-2-26(18-20-9-5-3-6-10-20)21-14-12-19(13-15-21)17-22-24(28)27-16-8-4-7-11-23(27)25-22/h3,5-6,9-10,12-15,17H,2,4,7-8,11,16,18H2,1H3/b22-17- |
| InChIKey | VTSCGAFWYSLKAV-XLNRJJMWSA-N |
| XLogP | 4.87 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|