About 2-methyl-5,8a-dihydro-1H-quinoline-8-thione
2-methyl-5,8a-dihydro-1H-quinoline-8-thione (PubChem CID 23069638) has the molecular formula C10H11NS
and a molecular weight of 177.27 g/mol. Its IUPAC name is 2-methyl-5,8a-dihydro-1H-quinoline-8-thione.
Molecular Properties
| Compound Name | 2-methyl-5,8a-dihydro-1H-quinoline-8-thione |
| PubChem CID | 23069638 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2-methyl-5,8a-dihydro-1H-quinoline-8-thione |
| SMILES | CC1=CC=C2CC=CC(=S)C2N1 |
| InChI | InChI=1S/C10H11NS/c1-7-5-6-8-3-2-4-9(12)10(8)11-7/h2,4-6,10-11H,3H2,1H3 |
| InChIKey | QRDVOWPXZHVYIS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5,8a-dihydro-1H-quinoline-8-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,8a-dihydro-1H-quinoline-8-thione?
The IUPAC name of 2-methyl-5,8a-dihydro-1H-quinoline-8-thione (CID 23069638) is 2-methyl-5,8a-dihydro-1H-quinoline-8-thione.
What is the SMILES notation for 2-methyl-5,8a-dihydro-1H-quinoline-8-thione?
The canonical SMILES for 2-methyl-5,8a-dihydro-1H-quinoline-8-thione is CC1=CC=C2CC=CC(=S)C2N1.
What is the InChIKey of 2-methyl-5,8a-dihydro-1H-quinoline-8-thione?
The InChIKey is QRDVOWPXZHVYIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS/c1-7-5-6-8-3-2-4-9(12)10(8)11-7/h2,4-6,10-11H,3H2,1H3.
What are the key properties of 2-methyl-5,8a-dihydro-1H-quinoline-8-thione?
2-methyl-5,8a-dihydro-1H-quinoline-8-thione has a molecular weight of 177.27 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,8a-dihydro-1H-quinoline-8-thione is sourced from PubChem (CID 23069638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).