About 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide
3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide (PubChem CID 23069952) has the molecular formula C22H15F6NO2
and a molecular weight of 439.36 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide.
Molecular Properties
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide |
| PubChem CID | 23069952 |
| Molecular Formula | C22H15F6NO2 |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide |
| SMILES | COc1c(C(N)=O)ccc(-c2ccccc2)c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H15F6NO2/c1-31-19-17(20(29)30)8-7-16(12-5-3-2-4-6-12)18(19)13-9-14(21(23,24)25)11-15(10-13)22(26,27)28/h2-11H,1H3,(H2,29,30) |
| InChIKey | YPLFFBJFFNZJTH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide?
The IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide (CID 23069952) is 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide.
What is the SMILES notation for 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide?
The canonical SMILES for 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide is COc1c(C(N)=O)ccc(-c2ccccc2)c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide?
The InChIKey is YPLFFBJFFNZJTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F6NO2/c1-31-19-17(20(29)30)8-7-16(12-5-3-2-4-6-12)18(19)13-9-14(21(23,24)25)11-15(10-13)22(26,27)28/h2-11H,1H3,(H2,29,30).
What are the key properties of 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide?
3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide has a molecular weight of 439.36 g/mol, XLogP of 6.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-4-phenylbenzamide is sourced from PubChem (CID 23069952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).