About 2-(2,2-dimethoxyethylsulfanyl)thiophene
2-(2,2-dimethoxyethylsulfanyl)thiophene (PubChem CID 23070270) has the molecular formula C8H12O2S2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylsulfanyl)thiophene.
Molecular Properties
| Compound Name | 2-(2,2-dimethoxyethylsulfanyl)thiophene |
| PubChem CID | 23070270 |
| Molecular Formula | C8H12O2S2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 2-(2,2-dimethoxyethylsulfanyl)thiophene |
| SMILES | COC(CSc1cccs1)OC |
| InChI | InChI=1S/C8H12O2S2/c1-9-7(10-2)6-12-8-4-3-5-11-8/h3-5,7H,6H2,1-2H3 |
| InChIKey | LWQLFTOXXXEGAY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethoxyethylsulfanyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethoxyethylsulfanyl)thiophene?
The IUPAC name of 2-(2,2-dimethoxyethylsulfanyl)thiophene (CID 23070270) is 2-(2,2-dimethoxyethylsulfanyl)thiophene.
What is the SMILES notation for 2-(2,2-dimethoxyethylsulfanyl)thiophene?
The canonical SMILES for 2-(2,2-dimethoxyethylsulfanyl)thiophene is COC(CSc1cccs1)OC.
What is the InChIKey of 2-(2,2-dimethoxyethylsulfanyl)thiophene?
The InChIKey is LWQLFTOXXXEGAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2S2/c1-9-7(10-2)6-12-8-4-3-5-11-8/h3-5,7H,6H2,1-2H3.
What are the key properties of 2-(2,2-dimethoxyethylsulfanyl)thiophene?
2-(2,2-dimethoxyethylsulfanyl)thiophene has a molecular weight of 204.32 g/mol, XLogP of 2.46, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethoxyethylsulfanyl)thiophene is sourced from PubChem (CID 23070270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).