About N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide
N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide (PubChem CID 23070366) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide |
| PubChem CID | 23070366 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC1=CC=CCC1 |
| InChI | InChI=1S/C11H17NO/c1-11(2,3)10(13)12-9-7-5-4-6-8-9/h4-5,7H,6,8H2,1-3H3,(H,12,13) |
| InChIKey | YLBWRHCSQMMZSO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide?
The IUPAC name of N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide (CID 23070366) is N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide.
What is the SMILES notation for N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide?
The canonical SMILES for N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide is CC(C)(C)C(=O)NC1=CC=CCC1.
What is the InChIKey of N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide?
The InChIKey is YLBWRHCSQMMZSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-11(2,3)10(13)12-9-7-5-4-6-8-9/h4-5,7H,6,8H2,1-3H3,(H,12,13).
What are the key properties of N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide?
N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide has a molecular weight of 179.26 g/mol, XLogP of 2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,3-dien-1-yl-2,2-dimethylpropanamide is sourced from PubChem (CID 23070366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).