C10H15Sm- — CID 23070514
1,2,3,5,5-pentamethylcyclopenta-1,3-diene;samarium (PubChem CID 23070514) has the molecular formula C10H15Sm- and a molecular weight of 285.59 g/mol. Its IUPAC name is 1,2,3,5,5-pentamethylcyclopenta-1,3-diene;samarium.
| Compound Name | 1,2,3,5,5-pentamethylcyclopenta-1,3-diene;samarium |
|---|---|
| PubChem CID | 23070514 |
| Molecular Formula | C10H15Sm- |
| Molecular Weight | 285.59 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 1,2,3,5,5-pentamethylcyclopenta-1,3-diene;samarium |
| SMILES | CC1=[C-]C(C)(C)C(C)=C1C.[Sm] |
| InChI | InChI=1S/C10H15.Sm/c1-7-6-10(4,5)9(3)8(7)2;/h1-5H3;/q-1; |
| InChIKey | UBXVCZLEJNTTOT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|