C18H23F3N6O4 — CID 23070687
8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-methoxy-1-methylpurin-6-one;2,2,2-trifluoroacetic acid (PubChem CID 23070687) has the molecular formula C18H23F3N6O4 and a molecular weight of 444.41 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-methoxy-1-methylpurin-6-one;2,2,2-trifluoroacetic acid.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-methoxy-1-methylpurin-6-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23070687 |
| Molecular Formula | C18H23F3N6O4 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2-methoxy-1-methylpurin-6-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2nc(OC)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N6O2.C2HF3O2/c1-4-5-9-22-12-13(19-16(24-3)20(2)14(12)23)18-15(22)21-8-6-7-11(17)10-21;3-2(4,5)1(6)7/h11H,6-10,17H2,1-3H3;(H,6,7) |
| InChIKey | CEBBCAJLVRBFKQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|