C16H19F3N6O3S — CID 23070697
7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-sulfanylidene-3H-purin-6-one;2,2,2-trifluoroacetic acid (PubChem CID 23070697) has the molecular formula C16H19F3N6O3S and a molecular weight of 432.43 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-sulfanylidene-3H-purin-6-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-sulfanylidene-3H-purin-6-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23070697 |
| Molecular Formula | C16H19F3N6O3S |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-sulfanylidene-3H-purin-6-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2[nH]c(=S)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18N6OS.C2HF3O2/c1-3-4-7-20-10-11(17-14(22)18(2)12(10)21)16-13(20)19-8-5-15-6-9-19;3-2(4,5)1(6)7/h15H,5-9H2,1-2H3,(H,17,22);(H,6,7) |
| InChIKey | LGFGFRAARUEMQS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|