C20H21F3N8O4 — CID 23070720
7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-yloxypurin-6-one;2,2,2-trifluoroacetic acid (PubChem CID 23070720) has the molecular formula C20H21F3N8O4 and a molecular weight of 494.43 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-yloxypurin-6-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-yloxypurin-6-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23070720 |
| Molecular Formula | C20H21F3N8O4 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-yloxypurin-6-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(Oc3ncccn3)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H20N8O2.C2HF3O2/c1-3-4-10-26-13-14(22-17(26)25-11-8-19-9-12-25)23-18(24(2)15(13)27)28-16-20-6-5-7-21-16;3-2(4,5)1(6)7/h5-7,19H,8-12H2,1-2H3;(H,6,7) |
| InChIKey | LNKHHBAKVLUNSC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 140.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|