C22H24F3N7O4 — CID 23070802
7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-(pyridin-2-ylmethoxy)purin-6-one;2,2,2-trifluoroacetic acid (PubChem CID 23070802) has the molecular formula C22H24F3N7O4 and a molecular weight of 507.47 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-(pyridin-2-ylmethoxy)purin-6-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-(pyridin-2-ylmethoxy)purin-6-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23070802 |
| Molecular Formula | C22H24F3N7O4 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-(pyridin-2-ylmethoxy)purin-6-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(OCc3ccccn3)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23N7O2.C2HF3O2/c1-3-4-11-27-16-17(23-19(27)26-12-9-21-10-13-26)24-20(25(2)18(16)28)29-14-15-7-5-6-8-22-15;3-2(4,5)1(6)7/h5-8,21H,9-14H2,1-2H3;(H,6,7) |
| InChIKey | WFIQUNIDEZWQSE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 127.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|