C20H21F3N8O3S — CID 23070924
7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanylpurin-6-one;2,2,2-trifluoroacetic acid (PubChem CID 23070924) has the molecular formula C20H21F3N8O3S and a molecular weight of 510.50 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanylpurin-6-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanylpurin-6-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23070924 |
| Molecular Formula | C20H21F3N8O3S |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanylpurin-6-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(Sc3ncccn3)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H20N8OS.C2HF3O2/c1-3-4-10-26-13-14(22-17(26)25-11-8-19-9-12-25)23-18(24(2)15(13)27)28-16-20-6-5-7-21-16;3-2(4,5)1(6)7/h5-7,19H,8-12H2,1-2H3;(H,6,7) |
| InChIKey | DQZZTEKCTKRVGK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|