C27H30F3N7O6 — CID 23070998
7-but-2-ynyl-1-methyl-2-[2-(morpholine-4-carbonyl)phenoxy]-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid (PubChem CID 23070998) has the molecular formula C27H30F3N7O6 and a molecular weight of 605.57 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-2-[2-(morpholine-4-carbonyl)phenoxy]-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-1-methyl-2-[2-(morpholine-4-carbonyl)phenoxy]-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23070998 |
| Molecular Formula | C27H30F3N7O6 |
| Molecular Weight | 605.57 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-2-[2-(morpholine-4-carbonyl)phenoxy]-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(Oc3ccccc3C(=O)N3CCOCC3)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H29N7O4.C2HF3O2/c1-3-4-11-32-20-21(27-24(32)31-12-9-26-10-13-31)28-25(29(2)23(20)34)36-19-8-6-5-7-18(19)22(33)30-14-16-35-17-15-30;3-2(4,5)1(6)7/h5-8,26H,9-17H2,1-2H3;(H,6,7) |
| InChIKey | BURAPCCXRYOXBC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.57 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|