C19H22F3N7O3S2 — CID 23071058
7-but-2-ynyl-2-methyl-8-piperazin-1-yl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydropurin-6-one;2,2,2-trifluoroacetic acid (PubChem CID 23071058) has the molecular formula C19H22F3N7O3S2 and a molecular weight of 517.56 g/mol. Its IUPAC name is 7-but-2-ynyl-2-methyl-8-piperazin-1-yl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydropurin-6-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-2-methyl-8-piperazin-1-yl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydropurin-6-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23071058 |
| Molecular Formula | C19H22F3N7O3S2 |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 7-but-2-ynyl-2-methyl-8-piperazin-1-yl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydropurin-6-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1C(=O)NC(C)(Sc1nccs1)N2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H21N7OS2.C2HF3O2/c1-3-4-8-24-12-13(20-15(24)23-9-5-18-6-10-23)21-17(2,22-14(12)25)27-16-19-7-11-26-16;3-2(4,5)1(6)7/h7,11,18,21H,5-6,8-10H2,1-2H3,(H,22,25);(H,6,7) |
| InChIKey | ZFYHBUQLKGKRKO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|