About 2-(methylamino)ethyl oxan-4-yl carbonate
2-(methylamino)ethyl oxan-4-yl carbonate (PubChem CID 23071197) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-(methylamino)ethyl oxan-4-yl carbonate.
Molecular Properties
| Compound Name | 2-(methylamino)ethyl oxan-4-yl carbonate |
| PubChem CID | 23071197 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-(methylamino)ethyl oxan-4-yl carbonate |
| SMILES | CNCCOC(=O)OC1CCOCC1 |
| InChI | InChI=1S/C9H17NO4/c1-10-4-7-13-9(11)14-8-2-5-12-6-3-8/h8,10H,2-7H2,1H3 |
| InChIKey | RWEKQEFRJMDWFE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)ethyl oxan-4-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)ethyl oxan-4-yl carbonate?
The IUPAC name of 2-(methylamino)ethyl oxan-4-yl carbonate (CID 23071197) is 2-(methylamino)ethyl oxan-4-yl carbonate.
What is the SMILES notation for 2-(methylamino)ethyl oxan-4-yl carbonate?
The canonical SMILES for 2-(methylamino)ethyl oxan-4-yl carbonate is CNCCOC(=O)OC1CCOCC1.
What is the InChIKey of 2-(methylamino)ethyl oxan-4-yl carbonate?
The InChIKey is RWEKQEFRJMDWFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-10-4-7-13-9(11)14-8-2-5-12-6-3-8/h8,10H,2-7H2,1H3.
What are the key properties of 2-(methylamino)ethyl oxan-4-yl carbonate?
2-(methylamino)ethyl oxan-4-yl carbonate has a molecular weight of 203.24 g/mol, XLogP of 0.54, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)ethyl oxan-4-yl carbonate is sourced from PubChem (CID 23071197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).