About CID 23071523
CID 23071523 (PubChem CID 23071523) has the molecular formula C9H25O2Si3
and a molecular weight of 249.55 g/mol.
Molecular Properties
| Compound Name | CID 23071523 |
| PubChem CID | 23071523 |
| Molecular Formula | C9H25O2Si3 |
| Molecular Weight | 249.55 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C9H25O2Si3/c1-9(2)12(10-13(3,4)5)11-14(6,7)8/h9H,1-8H3 |
| InChIKey | BXGBAHUENNJOLU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 23071523 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23071523?
The IUPAC name of CID 23071523 (CID 23071523) is not available.
What is the SMILES notation for CID 23071523?
The canonical SMILES for CID 23071523 is CC(C)[Si](O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of CID 23071523?
The InChIKey is BXGBAHUENNJOLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H25O2Si3/c1-9(2)12(10-13(3,4)5)11-14(6,7)8/h9H,1-8H3.
What are the key properties of CID 23071523?
CID 23071523 has a molecular weight of 249.55 g/mol, XLogP of 3.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23071523 is sourced from PubChem (CID 23071523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).