C22H25N7O — CID 23071563
4-(benzylamino)-2-(4-piperazin-1-ylanilino)pyrimidine-5-carboxamide (PubChem CID 23071563) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is 4-(benzylamino)-2-(4-piperazin-1-ylanilino)pyrimidine-5-carboxamide.
| Compound Name | 4-(benzylamino)-2-(4-piperazin-1-ylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 23071563 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 4-(benzylamino)-2-(4-piperazin-1-ylanilino)pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(N3CCNCC3)cc2)nc1NCc1ccccc1 |
| InChI | InChI=1S/C22H25N7O/c23-20(30)19-15-26-22(28-21(19)25-14-16-4-2-1-3-5-16)27-17-6-8-18(9-7-17)29-12-10-24-11-13-29/h1-9,15,24H,10-14H2,(H2,23,30)(H2,25,26,27,28) |
| InChIKey | RHKYFPVRIFLNNX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|