C16H28O — CID 23071630
2,6-ditert-butyl-4,4-dimethylcyclohexa-2,5-dien-1-ol (PubChem CID 23071630) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is 2,6-ditert-butyl-4,4-dimethylcyclohexa-2,5-dien-1-ol.
| Compound Name | 2,6-ditert-butyl-4,4-dimethylcyclohexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 23071630 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 2,6-ditert-butyl-4,4-dimethylcyclohexa-2,5-dien-1-ol |
| SMILES | CC1(C)C=C(C(C)(C)C)C(O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C16H28O/c1-14(2,3)11-9-16(7,8)10-12(13(11)17)15(4,5)6/h9-10,13,17H,1-8H3 |
| InChIKey | OZBRSZHWMXZTMW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|