C12H16N2 — CID 23072053
5,5a,5b,6,7,9a,10,10a-octahydroazepino[3,4-b]indole (PubChem CID 23072053) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 5,5a,5b,6,7,9a,10,10a-octahydroazepino[3,4-b]indole.
| Compound Name | 5,5a,5b,6,7,9a,10,10a-octahydroazepino[3,4-b]indole |
|---|---|
| PubChem CID | 23072053 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 5,5a,5b,6,7,9a,10,10a-octahydroazepino[3,4-b]indole |
| SMILES | C1=CC2NC3C=NC=CCC3C2CC1 |
| InChI | InChI=1S/C12H16N2/c1-2-6-11-9(4-1)10-5-3-7-13-8-12(10)14-11/h2-3,6-12,14H,1,4-5H2 |
| InChIKey | AYALPIUHNPNKAK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|