C18H30O — CID 23072321
1,1,2,3,3-pentamethyl-7-(2-methylprop-2-enoxy)-3a,4,5,6-tetrahydro-2H-indene (PubChem CID 23072321) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 1,1,2,3,3-pentamethyl-7-(2-methylprop-2-enoxy)-3a,4,5,6-tetrahydro-2H-indene.
| Compound Name | 1,1,2,3,3-pentamethyl-7-(2-methylprop-2-enoxy)-3a,4,5,6-tetrahydro-2H-indene |
|---|---|
| PubChem CID | 23072321 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 1,1,2,3,3-pentamethyl-7-(2-methylprop-2-enoxy)-3a,4,5,6-tetrahydro-2H-indene |
| SMILES | C=C(C)COC1=C2C(CCC1)C(C)(C)C(C)C2(C)C |
| InChI | InChI=1S/C18H30O/c1-12(2)11-19-15-10-8-9-14-16(15)18(6,7)13(3)17(14,4)5/h13-14H,1,8-11H2,2-7H3 |
| InChIKey | DDXNELWZVYEPRE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|