About 2-iodo-9,9-di(propan-2-yl)fluorene
2-iodo-9,9-di(propan-2-yl)fluorene (PubChem CID 23072844) has the molecular formula C19H21I
and a molecular weight of 376.28 g/mol. Its IUPAC name is 2-iodo-9,9-di(propan-2-yl)fluorene.
Molecular Properties
| Compound Name | 2-iodo-9,9-di(propan-2-yl)fluorene |
| PubChem CID | 23072844 |
| Molecular Formula | C19H21I |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-iodo-9,9-di(propan-2-yl)fluorene |
| SMILES | CC(C)C1(C(C)C)c2ccccc2-c2ccc(I)cc21 |
| InChI | InChI=1S/C19H21I/c1-12(2)19(13(3)4)17-8-6-5-7-15(17)16-10-9-14(20)11-18(16)19/h5-13H,1-4H3 |
| InChIKey | CMFHBESIIKDLPS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-9,9-di(propan-2-yl)fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-9,9-di(propan-2-yl)fluorene?
The IUPAC name of 2-iodo-9,9-di(propan-2-yl)fluorene (CID 23072844) is 2-iodo-9,9-di(propan-2-yl)fluorene.
What is the SMILES notation for 2-iodo-9,9-di(propan-2-yl)fluorene?
The canonical SMILES for 2-iodo-9,9-di(propan-2-yl)fluorene is CC(C)C1(C(C)C)c2ccccc2-c2ccc(I)cc21.
What is the InChIKey of 2-iodo-9,9-di(propan-2-yl)fluorene?
The InChIKey is CMFHBESIIKDLPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21I/c1-12(2)19(13(3)4)17-8-6-5-7-15(17)16-10-9-14(20)11-18(16)19/h5-13H,1-4H3.
What are the key properties of 2-iodo-9,9-di(propan-2-yl)fluorene?
2-iodo-9,9-di(propan-2-yl)fluorene has a molecular weight of 376.28 g/mol, XLogP of 5.87, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-9,9-di(propan-2-yl)fluorene is sourced from PubChem (CID 23072844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).