About 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide
3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide (PubChem CID 23073718) has the molecular formula C16H12F6N2O4S
and a molecular weight of 442.34 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide.
Molecular Properties
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide |
| PubChem CID | 23073718 |
| Molecular Formula | C16H12F6N2O4S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide |
| SMILES | COc1c(C(N)=O)cc(S(N)(=O)=O)cc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12F6N2O4S/c1-28-13-11(5-10(29(24,26)27)6-12(13)14(23)25)7-2-8(15(17,18)19)4-9(3-7)16(20,21)22/h2-6H,1H3,(H2,23,25)(H2,24,26,27) |
| InChIKey | ZBFLRGSFWLWHGG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide?
The IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide (CID 23073718) is 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide.
What is the SMILES notation for 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide?
The canonical SMILES for 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide is COc1c(C(N)=O)cc(S(N)(=O)=O)cc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide?
The InChIKey is ZBFLRGSFWLWHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F6N2O4S/c1-28-13-11(5-10(29(24,26)27)6-12(13)14(23)25)7-2-8(15(17,18)19)4-9(3-7)16(20,21)22/h2-6H,1H3,(H2,23,25)(H2,24,26,27).
What are the key properties of 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide?
3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide has a molecular weight of 442.34 g/mol, XLogP of 3.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(trifluoromethyl)phenyl]-2-methoxy-5-sulfamoylbenzamide is sourced from PubChem (CID 23073718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).