C12H14N2O2 — CID 23074043
5-piperidin-1-yl-3H-1,3-benzoxazol-2-one (PubChem CID 23074043) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-piperidin-1-yl-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-piperidin-1-yl-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 23074043 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 5-piperidin-1-yl-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(N3CCCCC3)ccc2o1 |
| InChI | InChI=1S/C12H14N2O2/c15-12-13-10-8-9(4-5-11(10)16-12)14-6-2-1-3-7-14/h4-5,8H,1-3,6-7H2,(H,13,15) |
| InChIKey | QJZBYEGUBIXKIG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |