C23H28FNO2S — CID 23074236
3,3-dibutyl-7-fluoro-5-phenyl-2H-1λ6,4-benzothiazepine 1,1-dioxide (PubChem CID 23074236) has the molecular formula C23H28FNO2S and a molecular weight of 401.55 g/mol. Its IUPAC name is 3,3-dibutyl-7-fluoro-5-phenyl-2H-1λ6,4-benzothiazepine 1,1-dioxide.
| Compound Name | 3,3-dibutyl-7-fluoro-5-phenyl-2H-1λ6,4-benzothiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 23074236 |
| Molecular Formula | C23H28FNO2S |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3,3-dibutyl-7-fluoro-5-phenyl-2H-1λ6,4-benzothiazepine 1,1-dioxide |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2ccc(F)cc2C(c2ccccc2)=N1 |
| InChI | InChI=1S/C23H28FNO2S/c1-3-5-14-23(15-6-4-2)17-28(26,27)21-13-12-19(24)16-20(21)22(25-23)18-10-8-7-9-11-18/h7-13,16H,3-6,14-15,17H2,1-2H3 |
| InChIKey | MBXMNPQCYCOYEN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |