C23H27FN2O4S — CID 23074237
3,3-dibutyl-7-fluoro-5-(3-nitrophenyl)-2H-1λ6,4-benzothiazepine 1,1-dioxide (PubChem CID 23074237) has the molecular formula C23H27FN2O4S and a molecular weight of 446.54 g/mol. Its IUPAC name is 3,3-dibutyl-7-fluoro-5-(3-nitrophenyl)-2H-1λ6,4-benzothiazepine 1,1-dioxide.
| Compound Name | 3,3-dibutyl-7-fluoro-5-(3-nitrophenyl)-2H-1λ6,4-benzothiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 23074237 |
| Molecular Formula | C23H27FN2O4S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 3,3-dibutyl-7-fluoro-5-(3-nitrophenyl)-2H-1λ6,4-benzothiazepine 1,1-dioxide |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2ccc(F)cc2C(c2cccc([N+](=O)[O-])c2)=N1 |
| InChI | InChI=1S/C23H27FN2O4S/c1-3-5-12-23(13-6-4-2)16-31(29,30)21-11-10-18(24)15-20(21)22(25-23)17-8-7-9-19(14-17)26(27)28/h7-11,14-15H,3-6,12-13,16H2,1-2H3 |
| InChIKey | IZPSOPIJMVERDR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 89.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|