About 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine
3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine (PubChem CID 23074256) has the molecular formula C23H28FNS
and a molecular weight of 369.55 g/mol. Its IUPAC name is 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine.
Molecular Properties
| Compound Name | 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine |
| PubChem CID | 23074256 |
| Molecular Formula | C23H28FNS |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine |
| SMILES | CCCCC1(CCCC)CSc2ccc(F)cc2C(c2ccccc2)=N1 |
| InChI | InChI=1S/C23H28FNS/c1-3-5-14-23(15-6-4-2)17-26-21-13-12-19(24)16-20(21)22(25-23)18-10-8-7-9-11-18/h7-13,16H,3-6,14-15,17H2,1-2H3 |
| InChIKey | DWHDKSVDUHLCJP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine?
The IUPAC name of 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine (CID 23074256) is 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine.
What is the SMILES notation for 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine?
The canonical SMILES for 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine is CCCCC1(CCCC)CSc2ccc(F)cc2C(c2ccccc2)=N1.
What is the InChIKey of 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine?
The InChIKey is DWHDKSVDUHLCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28FNS/c1-3-5-14-23(15-6-4-2)17-26-21-13-12-19(24)16-20(21)22(25-23)18-10-8-7-9-11-18/h7-13,16H,3-6,14-15,17H2,1-2H3.
What are the key properties of 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine?
3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine has a molecular weight of 369.55 g/mol, XLogP of 6.89, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dibutyl-7-fluoro-5-phenyl-2H-1,4-benzothiazepine is sourced from PubChem (CID 23074256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).