C21H29NO4 — CID 23074757
1-O-benzyl 2-O-butan-2-yl 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate (PubChem CID 23074757) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-O-benzyl 2-O-butan-2-yl 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-butan-2-yl 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23074757 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-O-benzyl 2-O-butan-2-yl 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate |
| SMILES | CCC(C)OC(=O)C1CC2CCCCC2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO4/c1-3-15(2)26-20(23)19-13-17-11-7-8-12-18(17)22(19)21(24)25-14-16-9-5-4-6-10-16/h4-6,9-10,15,17-19H,3,7-8,11-14H2,1-2H3 |
| InChIKey | HHFLGPGZPLFVHR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |