C21H29NO5 — CID 23074769
1-O-[(4-methoxyphenyl)methyl] 2-O-propyl 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate (PubChem CID 23074769) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-O-[(4-methoxyphenyl)methyl] 2-O-propyl 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate.
| Compound Name | 1-O-[(4-methoxyphenyl)methyl] 2-O-propyl 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23074769 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 1-O-[(4-methoxyphenyl)methyl] 2-O-propyl 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate |
| SMILES | CCCOC(=O)C1CC2CCCCC2N1C(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H29NO5/c1-3-12-26-20(23)19-13-16-6-4-5-7-18(16)22(19)21(24)27-14-15-8-10-17(25-2)11-9-15/h8-11,16,18-19H,3-7,12-14H2,1-2H3 |
| InChIKey | IUUWKJOHGIDNKW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |