C20H27NO5 — CID 23074791
2-O-ethyl 1-O-[(4-methoxyphenyl)methyl] 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate (PubChem CID 23074791) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-O-ethyl 1-O-[(4-methoxyphenyl)methyl] 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate.
| Compound Name | 2-O-ethyl 1-O-[(4-methoxyphenyl)methyl] 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23074791 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-O-ethyl 1-O-[(4-methoxyphenyl)methyl] 2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1CC2CCCCC2N1C(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H27NO5/c1-3-25-19(22)18-12-15-6-4-5-7-17(15)21(18)20(23)26-13-14-8-10-16(24-2)11-9-14/h8-11,15,17-18H,3-7,12-13H2,1-2H3 |
| InChIKey | XFZMSFGLPCITJD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |