About 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline
2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline (PubChem CID 23074916) has the molecular formula C12H13F3N2O
and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline.
Molecular Properties
| Compound Name | 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline |
| PubChem CID | 23074916 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline |
| SMILES | CC1=NOC(c2ccc(N)c(C)c2)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H13F3N2O/c1-7-5-9(3-4-10(7)16)11(12(13,14)15)6-8(2)17-18-11/h3-5H,6,16H2,1-2H3 |
| InChIKey | FEHMCFVQSDNPFK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline?
The IUPAC name of 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline (CID 23074916) is 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline.
What is the SMILES notation for 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline?
The canonical SMILES for 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline is CC1=NOC(c2ccc(N)c(C)c2)(C(F)(F)F)C1.
What is the InChIKey of 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline?
The InChIKey is FEHMCFVQSDNPFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3N2O/c1-7-5-9(3-4-10(7)16)11(12(13,14)15)6-8(2)17-18-11/h3-5H,6,16H2,1-2H3.
What are the key properties of 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline?
2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline has a molecular weight of 258.24 g/mol, XLogP of 3.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[3-methyl-5-(trifluoromethyl)-4H-1,2-oxazol-5-yl]aniline is sourced from PubChem (CID 23074916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).