C15H10O6 — CID 23075085
9,10-dihydroxy-5,8-dioxo-6,7-dihydroanthracene-2-carboxylic acid (PubChem CID 23075085) has the molecular formula C15H10O6 and a molecular weight of 286.24 g/mol. Its IUPAC name is 9,10-dihydroxy-5,8-dioxo-6,7-dihydroanthracene-2-carboxylic acid.
| Compound Name | 9,10-dihydroxy-5,8-dioxo-6,7-dihydroanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 23075085 |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 9,10-dihydroxy-5,8-dioxo-6,7-dihydroanthracene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(O)c3c(c(O)c2c1)C(=O)CCC3=O |
| InChI | InChI=1S/C15H10O6/c16-9-3-4-10(17)12-11(9)13(18)7-2-1-6(15(20)21)5-8(7)14(12)19/h1-2,5,18-19H,3-4H2,(H,20,21) |
| InChIKey | DPBBROFMQALIQY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|