C19H26N4O3S — CID 23075878
4-methyl-N-[3-(3-piperidin-1-ylpropoxy)pyrazin-2-yl]benzenesulfonamide (PubChem CID 23075878) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-methyl-N-[3-(3-piperidin-1-ylpropoxy)pyrazin-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[3-(3-piperidin-1-ylpropoxy)pyrazin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23075878 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-methyl-N-[3-(3-piperidin-1-ylpropoxy)pyrazin-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nccnc2OCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C19H26N4O3S/c1-16-6-8-17(9-7-16)27(24,25)22-18-19(21-11-10-20-18)26-15-5-14-23-12-3-2-4-13-23/h6-11H,2-5,12-15H2,1H3,(H,20,22) |
| InChIKey | LOYFOEKMJUSZLG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|